Name | Value |
---|---|
InChI=1S/C8H10N4O2/c1-10-4-9-6-5(10)7(13)12(3)8(14)11(6)2/h4H,1-3H3 | |
RYYVLZVUVIJVGH-UHFFFAOYSA-N | |
C8H10N4O2 | |
194.08037556 | |
O=C1C2=C(N=CN2C)N(C(=O)N1C)C |
External Identifier | Value |
---|---|
58-08-2 | |
27732 | |
D00528 | |
2519 | |
2424 |
Name | Value |
---|---|
KW107902 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
194.0804 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV FT-MS | |
7500 | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
5.873 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.7457269305874383 | |
0.4161981244662937 | |
195.0877 | |
[M+H]+ | |
3.309075866807903 ppm | |
-6.455599999810602E-4 Da |