Name | Value |
---|---|
InChI=1S/C15H25NO3/c1-12(2)16-10-14(17)11-19-15-6-4-13(5-7-15)8-9-18-3/h4-7,12,14,16-17H,8-11H2,1-3H3 | |
IUBSYMUCCVWXPE-UHFFFAOYSA-N | |
C15H25NO3 | |
267.18344365999997 | |
OC(COC1=CC=C(C=C1)CCOC)CNC(C)C |
External Identifier | Value |
---|---|
37350-58-6 | |
6904 | |
D02358 | |
4171 | |
4027 |
Name | Value |
---|---|
KW108004 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
267.1834 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
65 eV FT-MS | |
30000 | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
8.915 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
2.362689842689888 | |
0.7090470694326203 | |
268.1907 | |
[M+H]+ | |
2.661016955375299 ppm | |
-7.136599999739701E-4 Da |