Name | Value |
---|---|
InChI=1S/C12H15NO3/c1-12(2)7-8-5-4-6-9(10(8)16-12)15-11(14)13-3/h4-6H,7H2,1-3H3,(H,13,14) | |
DUEPRVBVGDRKAG-UHFFFAOYSA-N | |
C12H15NO3 | |
221.10519333999997 | |
OC(=NC)OC1=CC=CC2=C1OC(C)(C)C2 |
External Identifier | Value |
---|---|
1563-66-2 | |
34611 | |
C14291 | |
2566 | |
2468 |
Name | Value |
---|---|
KW108403 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
221.1052 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV FT-MS II | |
30000 | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
15.352 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.1935813289421963 | |
0.12027884235026223 | |
222.1125 | |
[M+H]+ | |
2.986504586459763 ppm | |
-6.633399999600442E-4 Da |