Name | Value |
---|---|
InChI=1S/C12H10O4S/c13-9-1-5-11(6-2-9)17(15,16)12-7-3-10(14)4-8-12/h1-8,13-14H | |
VPWNQTHUCYMVMZ-UHFFFAOYSA-N | |
C12H10O4S | |
250.0299798 | |
O=S(=O)(C1=CC=C(O)C=C1)C2=CC=C(O)C=C2 |
External Identifier | Value |
---|---|
80-09-1 | |
34372 | |
C14216 | |
6626 | |
6374 |
Name | Value |
---|---|
KW108601 | |
2017.03.12 | |
Erik Emke, Andrea Brunner, KWR | |
CC BY | |
Copyright (C) 2017 KWR watercycle research institute | |
250.03 | |
Orbitrap Classic, Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 eV IT-MS | |
nominal | |
XBridge C18 3.5um, 2.1x150mm, Waters | |
95/5 at 0 min, 0/100 at 40 min, 0/100 at 45 min, 95/5 at 47 min, 95/5 at 52 min | |
300 uL/min | |
11.889 min | |
water with 0.05% formic acid | |
acetonitrile with 0.05% formic acid | |
identity | |
Peaks with additional N2/O included | |
RMassBank 2.2.0 | |
positive | |
0.0 | |
NaN | |
251.0373 | |
[M+H]+ | |
2.588459962002621 ppm | |
-6.498000000192405E-4 Da |