Name | Value |
---|---|
InChI=1S/C18H28O5/c1-21-18(20)7-5-3-2-4-6-16-8-10-17(11-9-16)23-15-14-22-13-12-19/h8-11,19H,2-7,12-15H2,1H3 | |
RRPVDZMCSBPRCV-UHFFFAOYSA-N | |
C18H28O5 | |
324.193673996 | |
O=C(OC)CCCCCCC1=CC=C(OCCOCCO)C=C1 |
External Identifier | Value |
---|---|
137628522 |
Name | Value |
---|---|
LIT00033 | |
2016.02.03 (Created 2013.04.16) | |
E. Schymanski; retrieved from A. Di Corcia et al. 1998 | |
CC0 | |
Copyright (C) American Chemical Society 1998 | |
Corcia, A. D.; Costantino, A.; Crescenzi, C.; Marinoni, E.; Samperi, R. Characterization of Recalcitrant Intermediates from Biotransformation of the Branched Alkyl Side Chain of Nonylphenol Ethoxylate Surfactants. Environmental Science & Technology 1998, 32 (16), 2401–9. DOI:10.1021/es9801285 | |
324.1937 | |
Fisons VG Platform | |
LC-ESI-Q | |
MS2 | |
ESI | |
CID | |
40 V | |
Hand-digitised from figures | |
positive | |
2.3826297588806753 | |
0.8593520343529042 | |
325.201 | |
[M+H]+ | |
1.9803014134370134 ppm | |
-6.439959999511302E-4 Da |