Name | Value |
---|---|
InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21-/m1/s1 | |
WMBWREPUVVBILR-WIYYLYMNSA-N | |
C22H18O11 | |
458.084911396 | |
O=C(OC1CC=2C(O)=CC(O)=CC2OC1C3=CC(O)=C(O)C(O)=C3)C4=CC(O)=C(O)C(O)=C4 |
External Identifier | Value |
---|---|
863-65-0 | |
4806 | |
C09731 | |
LMPK12030005 | |
65064 | |
58575 |
Name | Value |
---|---|
LU080856 | |
2020.08.19 | |
Kondić, T.;Singh, R.;Elapavalore, A.;Schymanski, E. | |
CC0 | |
Copyright © 2019 by Environmental Cheminformatics, LCSB, University of Luxembourg, Luxembourg | |
458.0849 | |
Q Exactive Orbitrap (Thermo Scientific) | |
LC-ESI-QFT | |
MS2 | |
ESI | |
HCD | |
90 | |
17500 | |
Acquity BEH C18 1.7um, 2.1x150mm (Waters) | |
90/10 at 0-2 min, 0/100 at 15-20 min, 90/10 at 20.1-30 min | |
0.20 mL/min | |
11.181 min | |
0.1% formic acid | |
methanol | |
854193.0844727 | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.99.2 | |
negative | |
2.2292991934448225 | |
0.8040497227601529 | |
457.0776 | |
[M-H]- | |
0.07743980450372376 ppm | |
-3.5395999987031246E-5 Da |