Name | Value |
---|---|
InChI=1S/C15H21N5O5/c1-8(4-21)2-3-16-13-10-14(18-6-17-13)20(7-19-10)15-12(24)11(23)9(5-22)25-15/h2,6-7,9,11-12,15,21-24H,3-5H2,1H3,(H,16,17,18)/t9-,11-,12-,15-/m1/s1 | |
GOSWTRUMMSCNCW-SDBHATRESA-N | |
C15H21N5O5 | |
351.154268772 | |
OCC(=CCNC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3O)C |
External Identifier | Value |
---|---|
71693 | |
161606 | |
4945213 |
Name | Value |
---|---|
ML002301 | |
2014.11.12 | |
Mark Earll, Stephan Beisken, EMBL-EBI | |
CC BY-SA | |
Copyright (C) 2014, European Molecular Biology Laboratory - European Bioinformatics Institute (EMBL-EBI), Hinxton, UK. | |
Beisken S et al (2014) Scientific Data, 1:140029, DOI:10.1038/sdata.2014.29. http://www.ebi.ac.uk/metabolights/MTBLS38 | |
351.1543 | |
LTQ Orbitrap Velos Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
HCD | |
50 % (nominal) | |
7500 | |
HSS T3 1.7 um, 2x150 mm, Waters | |
100/0 at 0 min, 90/10 at 7.5 min, 0/100 at 10 min, 0/100 at 12 min, 100/0 at 18 min, 100/0 at 25 min | |
250 uL/min at 0 min, 400 uL/min at 7.5 min | |
8.9 min | |
0.2% Formic Acid | |
98/2/0.2 Acetonitrile/Water/Formic Acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 1.7.0 | |
positive | |
1.306189678934016 | |
0.5447234054595211 | |
352.1615 | |
[M+H]+ | |
2.097821596153483 ppm | |
-7.387720000338049E-4 Da |