Name | Value |
---|---|
Non-Natural Product | |
InChI=1S/C18H20FN3O4/c1-10-9-26-17-14-11(16(23)12(18(24)25)8-22(10)14)7-13(19)15(17)21-5-3-20(2)4-6-21/h7-8,10H,3-6,9H2,1-2H3,(H,24,25) | |
GSDSWSVVBLHKDQ-UHFFFAOYSA-N | |
C18H20FN3O4 | |
361.14378434 | |
O=C(O)C1=CN2C3=C(OCC2C)C(=C(F)C=C3C1=O)N4CCN(C)CC4 |
External Identifier | Value |
---|---|
4422 | |
4583 |
Name | Value |
---|---|
MSJ00032 | |
2016.01.19 (Created 2014.07.24) | |
CASMI2013 organizers | |
CC BY-SA | |
Mass Spectrometry Society of Japan | |
CASMI2013 Challenge_16 MS1 data, retention time = 3.7 min | |
361.14378 | |
Dionex U3000 and Exactive Orbitrap (Thermofisher Scientific) | |
LC-ESI-ITFT | |
MS1 | |
ESI | |
10 ppm | |
L-column 2 ODS | |
0 to 5 min, a linear increase from 10% to 100% B 5 to 10 min, hold at 100% B and 10 to 15 min, equilibration at 10% B | |
0.2 mL/min | |
methanol containing 2 mM formate | |
water containing 2 mM formate | |
positive | |
0.5081711585966978 | |
0.4625573223951221 |