Name | Value |
---|---|
InChI=1S/C14H10O3/c15-10-5-1-3-8-7-9-4-2-6-11(16)13(9)14(17)12(8)10/h1-7,15-17H | |
YUTJCNNFTOIOGT-UHFFFAOYSA-N | |
C14H10O3 | |
226.06299417999998 | |
OC1=CC=CC=2C=C3C=CC=C(O)C3=C(O)C12 |
External Identifier | Value |
---|---|
480-22-8 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
MS2 | |
5 | |
Nitrogen | |
20 | |
0.016 | |
2014-07-26 01:11:21+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
819 | |
C:\Data\Confirmed standards 24_July_2014\MSMS\1,8,9-Anthracenetriol vial 28_1-A,4_01_484.d | |
0.8279540168021854 | |
0.5144367548481537 | |
449.1031 |