Name | Value |
---|---|
C20H20O5 | |
340.13107374 | |
O=C1C2=C(O)C(=C(O)C=C2OC(C3=CC=C(O)C=C3)C1)CC=C(C)C | |
InChI=1S/C20H20O5/c1-11(2)3-8-14-15(22)9-18-19(20(14)24)16(23)10-17(25-18)12-4-6-13(21)7-5-12/h3-7,9,17,21-22,24H,8,10H2,1-2H3/t17-/m0/s1 | |
YHWNASRGLKJRJJ-KRWDZBQOSA-N |
External Identifier | Value |
---|---|
68236-13-5 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.0062 | |
2013-07-03 06:09:58+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
1120.8 | |
D:\Data\Confirmed Standards\Reinjection_1uL\6-Prenylnaringenin (vial 48).d | |
0.8140403204483101 | |
0.2936029833486099 |