Name | Value |
---|---|
InChI=1S/C8H8O4/c1-12-7-4-5(8(10)11)2-3-6(7)9/h2-4,9H,1H3,(H,10,11) | |
WKOLLVMJNQIZCI-UHFFFAOYSA-N | |
C8H8O4 | |
168.042258736 | |
O=C(O)C1=CC=C(O)C(OC)=C1 |
External Identifier | Value |
---|---|
121-34-6 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
0.7917918333967612 | |
Nitrogen | |
0.03 | |
2013-09-04 02:23:07+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
154.8 | |
D:\Data\Confirmed Standards\Reinjection 2 uL\Vanillic Acid (vial 31)_1490.d | |
2.5797342312236697 |