Name | Value |
---|---|
C21H20O11 | |
448.10056146 | |
O=C1C(OC2OC(C)C(O)C(O)C2O)=C(OC=3C=C(O)C=C(O)C13)C=4C=CC(O)=C(O)C4 | |
InChI=1S/C21H20O11/c1-7-15(26)17(28)18(29)21(30-7)32-20-16(27)14-12(25)5-9(22)6-13(14)31-19(20)8-2-3-10(23)11(24)4-8/h2-7,15,17-18,21-26,28-29H,1H3 | |
OXGUCUVFOIWWQJ-UHFFFAOYSA-N |
External Identifier | Value |
---|---|
522-12-3 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.026 | |
2013-09-05 05:28:37+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
366.6 | |
C:\Data\Confirmed Standards\Reinjection 2 uL\Quercitrin (vial 53).d | |
1.8759523624521688 | |
0.6490349752855431 |