Name | Value |
---|---|
C27H30O14 | |
578.16355564 | |
O=C1C=C(OC2=CC(OC3OC(COC4OC(C)C(O)C(O)C4O)C(O)C(O)C3O)=CC(O)=C12)C=5C=CC(O)=CC5 | |
InChI=1S/C27H30O14/c1-10-20(31)22(33)24(35)26(38-10)37-9-18-21(32)23(34)25(36)27(41-18)39-13-6-14(29)19-15(30)8-16(40-17(19)7-13)11-2-4-12(28)5-3-11/h2-8,10,18,20-29,31-36H,9H2,1H3 | |
FKIYLTVJPDLUDL-UHFFFAOYSA-N |
External Identifier | Value |
---|---|
552-57-8 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.026 | |
2013-09-05 07:30:57+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
384.6 | |
C:\Data\Confirmed Standards\Reinjection 2 uL\Isorhoifolin (vial 56).d | |
1.190559592791061 | |
0.5170534615261403 |