Name | Value |
---|---|
InChI=1S/C16H12O4/c1-19-12-5-2-10(3-6-12)15-9-14(18)13-7-4-11(17)8-16(13)20-15/h2-9,17H,1H3 | |
SQVXWIUVAILQRH-UHFFFAOYSA-N | |
C16H12O4 | |
268.073558864 | |
O=C1C=C(OC2=CC(O)=CC=C12)C=3C=CC(OC)=CC3 |
External Identifier | Value |
---|---|
487-17-2 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.014 | |
2013-11-23 00:43:36+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
694.2 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 22Nov13\7Methoxy4'hydroxyflavone MSMS.d | |
1.6662054858446018 | |
0.5561930552184815 |