Name | Value |
---|---|
InChI=1S/C15H8O5/c16-7-1-3-9-11(5-7)19-14-10-4-2-8(17)6-12(10)20-15(18)13(9)14/h1-6,16-17H | |
ZZIALNLLNHEQPJ-UHFFFAOYSA-N | |
C15H8O5 | |
268.037173356 | |
O=C1OC=2C=C(O)C=CC2C=3OC4=CC(O)=CC=C4C13 |
External Identifier | Value |
---|---|
479-13-0 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
MS2 | |
5 | |
Nitrogen | |
40 | |
0.017 | |
2014-08-05 21:09:28+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
580.2 | |
C:\Data\Confirmed standards 24_July_2014\MSMS\Coumestrol vial 81 dil 1 to 10_1-F,5_01_539.d | |
2.2902161895853133 | |
0.7923604233015027 | |
266.0373 |