Name | Value |
---|---|
InChI=1S/C21H20O11/c22-7-16-18(27)19(28)20(29)21(32-16)31-13-2-1-8(3-10(13)24)14-6-12(26)17-11(25)4-9(23)5-15(17)30-14/h1-6,16,18-25,27-29H,7H2/t16-,18-,19+,20-,21-/m1/s1 | |
UHNXUSWGOJMEFO-QNDFHXLGSA-N | |
C21H20O11 | |
448.10056146 | |
O=C1C=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(OC4OC(CO)C(O)C(O)C4O)=C(O)C3 |
External Identifier | Value |
---|---|
6920-38-3 |
Name | Value |
---|---|
375.6 | |
5 | |
Nitrogen | |
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
MS2 | |
20 | |
0.013 | |
2013-11-08 01:16:08+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\Luteolin-4-O-glucoside MSMS.d | |
0.502784899350214 | |
0.45765453794419103 | |
447.0938 | |
[M-H]- | |
1.1508546975674878 ppm | |
5.145399999832989E-4 Da |