Name | Value |
---|---|
InChI=1S/C15H10O7/c16-7-3-8(17)14-9(18)5-12(22-13(14)4-7)6-1-10(19)15(21)11(20)2-6/h1-5,16-17,19-21H | |
ARSRJFRKVXALTF-UHFFFAOYSA-N | |
C15H10O7 | |
302.04265266 | |
O=C1C=C(OC=2C=C(O)C=C(O)C12)C=3C=C(O)C(O)=C(O)C3 |
External Identifier | Value |
---|---|
520-31-0 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.02 | |
2013-11-07 04:44:57+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
390 | |
C:\Data\Confirmed Standards\Confirmed Stds 6Nov13\Tricetin (vial 72).d | |
2.3728167949952197 | |
0.7120861843111963 |