Name | Value |
---|---|
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H | |
GYLUFQJZYAJQDI-UHFFFAOYSA-N | |
C15H10O5 | |
270.05282342 | |
O=C1C(=COC2=CC(O)=C(O)C=C12)C=3C=CC(O)=CC3 |
External Identifier | Value |
---|---|
17817-31-1 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.016 | |
2013-11-08 12:49:31+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
392.4 | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\6,7,4-Trihydroxyisoflavone.d | |
0.7599376303836324 | |
0.390530688558545 |