Name | Value |
---|---|
InChI=1S/C15H10O5/c16-9-3-1-8(2-4-9)11-7-20-14-6-13(18)12(17)5-10(14)15(11)19/h1-7,16-18H | |
GYLUFQJZYAJQDI-UHFFFAOYSA-N | |
C15H10O5 | |
270.05282342 | |
O=C1C(=COC2=CC(O)=C(O)C=C12)C=3C=CC(O)=CC3 |
External Identifier | Value |
---|---|
17817-31-1 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
MS2 | |
5 | |
Nitrogen | |
40 | |
0.021 | |
2013-11-09 11:36:45+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
392.4 | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\6,7,4-Trihydroxyisoflavone MSM.d | |
3.4316944014564075 | |
0.8913150238531652 | |
269.0453 | |
[M-H]- | |
0.9196220859230061 ppm | |
-2.4741999999378095E-4 Da |