Name | Value |
---|---|
InChI=1S/C21H20O10/c22-7-14-17(27)18(28)19(29)21(31-14)16-11(25)5-10(24)15-12(26)6-13(30-20(15)16)8-1-3-9(23)4-2-8/h1-6,14,17-19,21-25,27-29H,7H2/t14-,17-,18+,19-,21+/m1/s1 | |
SGEWCQFRYRRZDC-VPRICQMDSA-N | |
C21H20O10 | |
432.10564683999996 | |
O=C1C=C(OC=2C1=C(O)C=C(O)C2C3OC(CO)C(O)C(O)C3O)C=4C=CC(O)=CC4 |
External Identifier | Value |
---|---|
3681-93-4 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.016 | |
2013-11-08 10:06:26+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
297 | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\Vitexin (vial 86).d | |
0.938835932465532 | |
0.4824662294511961 |