Name | Value |
---|---|
InChI=1S/C21H20O9/c22-7-14-17(26)18(27)19(28)21(30-14)15-13(24)6-5-11-16(25)12(8-29-20(11)15)9-1-3-10(23)4-2-9/h1-6,8,14,17-19,21-24,26-28H,7H2/t14-,17-,18+,19-,21+/m1/s1 | |
HKEAFJYKMMKDOR-VPRICQMDSA-N | |
C21H20O9 | |
416.11073222 | |
O=C1C(=COC=2C1=CC=C(O)C2C3OC(CO)C(O)C(O)C3O)C=4C=CC(O)=CC4 |
Name | Value |
---|---|
LC-ESI-TOF | |
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.018 | |
2013-11-08 15:32:36+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
187.2 | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\Puerarin (vial 94).d | |
0.6621444892564171 | |
0.41141350290114354 |