Name | Value |
---|---|
InChI=1S/C21H22O10/c22-8-16-18(26)19(27)20(28)21(31-16)29-11-5-12(24)17-13(25)7-14(30-15(17)6-11)9-1-3-10(23)4-2-9/h1-6,14,16,18-24,26-28H,7-8H2/t14-,16+,18+,19-,20+,21+/m0/s1 | |
DLIKSSGEMUFQOK-SFTVRKLSSA-N | |
C21H22O10 | |
434.121296904 | |
O=C1C2=C(O)C=C(OC3OC(CO)C(O)C(O)C3O)C=C2OC(C4=CC=C(O)C=C4)C1 |
External Identifier | Value |
---|---|
529-55-5 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.012 | |
2013-11-19 05:00:43+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
375 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 14Nov13\Naringenin7glucoside MSMS v115.d | |
1.6009989969919571 | |
0.6442893929752034 |