Name | Value |
---|---|
InChI=1S/C21H20O11/c22-6-14-17(28)18(29)19(30)21(32-14)16-11(26)4-10(25)15-12(27)5-13(31-20(15)16)7-1-2-8(23)9(24)3-7/h1-5,14,17-19,21-26,28-30H,6H2/t14-,17-,18+,19-,21+/m1/s1 | |
PLAPMLGJVGLZOV-VPRICQMDSA-N | |
C21H20O11 | |
448.10056146 | |
O=C1C=C(OC=2C1=C(O)C=C(O)C2C3OC(CO)C(O)C(O)C3O)C=4C=CC(O)=C(O)C4 |
External Identifier | Value |
---|---|
28608-75-5 |
Name | Value |
---|---|
ESI | |
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
negative | |
Nitrogen | |
10 | |
0.018 | |
2013-11-09 02:05:34+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
254.4 | |
C:\Data\Confirmed Standards\Confirmed Stds 7Nov13\Orientin (vial 107).d | |
2.055383141074643 | |
0.7111137643313777 |