Name | Value |
---|---|
InChI=1S/C15H10O7/c16-7-4-10(19)12-11(5-7)22-15(14(21)13(12)20)6-1-2-8(17)9(18)3-6/h1-5,16-19,21H | |
REFJWTPEDVJJIY-UHFFFAOYSA-N | |
C15H10O7 | |
302.04265266 | |
O=C1C(O)=C(OC=2C=C(O)C=C(O)C12)C=3C=CC(O)=C(O)C3 |
External Identifier | Value |
---|---|
117-39-5 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
MS2 | |
5 | |
Nitrogen | |
40 | |
0.014 | |
2014-01-10 00:24:33+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
483.6 | |
C:\Data\Confirmed Standards\14Jan9 Confirmed stds MSMS\ZLei_Std_Mix_30_Oct_13_2485.d | |
2.6165095858749705 | |
0.9437063509950638 | |
301 | |
[M-H]- | |
117.53043189367831 ppm | |
-0.03537665999999717 Da |