Name | Value |
---|---|
C16H14O6 | |
302.079038168 | |
O=C1C=2C(O)=CC(O)=CC2OC(C3=CC=C(OC)C(O)=C3)C1 | |
InChI=1S/C16H14O6/c1-21-13-3-2-8(4-10(13)18)14-7-12(20)16-11(19)5-9(17)6-15(16)22-14/h2-6,14,17-19H,7H2,1H3 | |
AIONOLUJZLIMTK-UHFFFAOYSA-N |
External Identifier | Value |
---|---|
520-33-2 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.014 | |
2013-11-23 07:31:07+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
623.4 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 22Nov13\Hesperetin (vial 258).d | |
0.9254817221301174 | |
0.30893338844067364 |