Name | Value |
---|---|
InChI=1S/C16H12O4/c1-19-11-7-12(17)16-13(18)9-14(20-15(16)8-11)10-5-3-2-4-6-10/h2-9,17H,1H3 | |
IRZVHDLBAYNPCT-UHFFFAOYSA-N | |
C16H12O4 | |
268.073558864 | |
O=C1C=C(OC=2C=C(OC)C=C(O)C12)C=3C=CC=CC3 |
External Identifier | Value |
---|---|
520-28-5 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.017 | |
2013-11-22 00:03:03+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
1133.4 | |
C:\Data\Confirmed Standards\Confirmed Stds 21Nov13\Tectochrysin (vial 290).d | |
1.8941428549571788 | |
0.632280418273179 |