Name | Value |
---|---|
InChI=1S/C18H16O6/c1-21-11-6-4-10(5-7-11)17-18(23-3)16(20)15-13(19)8-12(22-2)9-14(15)24-17/h4-9,19H,1-3H3 | |
WSQWAMGRHJQANC-UHFFFAOYSA-N | |
C18H16O6 | |
328.09468823199995 | |
O=C1C(OC)=C(OC=2C=C(OC)C=C(O)C12)C=3C=CC(OC)=CC3 |
External Identifier | Value |
---|---|
15486-34-7 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
10 | |
0.015 | |
2013-11-21 20:01:53+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
1224.6 | |
C:\Data\Confirmed Standards\Confirmed Stds 21Nov13\Kaempferol374'trimethyle 3 uL.d | |
2.515946189703388 | |
0.6689211188752315 |