Name | Value |
---|---|
InChI=1S/C19H18O9/c1-24-12-6-8(5-10(21)16(12)25-2)11-7-9(20)13-14(22)18(26-3)15(23)19(27-4)17(13)28-11/h5-7,21-23H,1-4H3 | |
NYKXAPFHNLNAIJ-UHFFFAOYSA-N | |
C19H18O9 | |
390.095082156 | |
O=C1C=C(OC=2C(OC)=C(O)C(OC)=C(O)C12)C=3C=C(O)C(OC)=C(OC)C3 |
External Identifier | Value |
---|---|
18398-74-8 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.011 | |
2014-01-04 04:34:50+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
722.4 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 2Jan14\Scaposin (v298)_MSMS_2402.d | |
1.4070561094380445 | |
0.4696868681688907 |