Name | Value |
---|---|
InChI=1S/C16H12O5/c1-20-11-6-12(18)16-13(19)8-14(21-15(16)7-11)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3 | |
JPMYFOBNRRGFNO-UHFFFAOYSA-N | |
C16H12O5 | |
284.068473484 | |
O=C1C=C(OC=2C=C(OC)C=C(O)C12)C=3C=CC(O)=CC3 |
External Identifier | Value |
---|---|
437-64-9 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.017 | |
2014-01-04 18:09:28+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
874.8 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 2Jan14\54'Dihydroxy7methoxyfla_MSMS.d | |
0.9255373758870172 | |
0.35070756724407687 |