Name | Value |
---|---|
C21H20O9 | |
416.11073222 | |
O=C1C(=COC2=CC(OC3OC(CO)C(O)C(O)C3O)=CC=C12)C=4C=CC(O)=CC4 | |
InChI=1S/C21H20O9/c22-8-16-18(25)19(26)20(27)21(30-16)29-12-5-6-13-15(7-12)28-9-14(17(13)24)10-1-3-11(23)4-2-10/h1-7,9,16,18-23,25-27H,8H2 | |
KYQZWONCHDNPDP-UHFFFAOYSA-N |
External Identifier | Value |
---|---|
552-66-9 |
Name | Value |
---|---|
ESI | |
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
negative | |
Nitrogen | |
0.014 | |
2014-01-08 05:24:55+01:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
245.4 | |
C:\Data\Confirmed Standards\Confirmed stds MSMS 7Jan14\Daidzin (vial 323)_MSMS.d | |
1.4063445531042538 | |
0.46192615816484645 |