Name | Value |
---|---|
InChI=1S/C22H18O10/c23-11-6-14(25)12-8-19(32-22(30)10-4-16(27)20(29)17(28)5-10)21(31-18(12)7-11)9-1-2-13(24)15(26)3-9/h1-7,19,21,23-29H,8H2/t19-,21+/m1/s1 | |
LSHVYAFMTMFKBA-CTNGQTDRSA-N | |
C22H18O10 | |
442.089996776 | |
O=C(OC1CC=2C(O)=CC(O)=CC2OC1C3=CC=C(O)C(O)=C3)C4=CC(O)=C(O)C(O)=C4 |
External Identifier | Value |
---|---|
130405-40-2 |
Name | Value |
---|---|
ESI | |
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
negative | |
MS2 | |
5 | |
Nitrogen | |
10 | |
0.016 | |
2014-08-19 20:50:17+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
283.8 | |
C:\Data\Confirmed standards 19_Aug_2014\Catechin gallate vial 371_1-E,3_01_657.d | |
1.46664946465628 | |
0.5902231638284711 | |
441.0846 | |
[M-H]- | |
4.260461598506315 ppm | |
0.0018792239999925187 Da |