Name | Value |
---|---|
InChI=1S/C30H26O12/c31-13-7-20(37)24-23(8-13)41-29(12-2-4-16(33)19(36)6-12)27(40)26(24)25-21(38)10-17(34)14-9-22(39)28(42-30(14)25)11-1-3-15(32)18(35)5-11/h1-8,10,22,26-29,31-40H,9H2/t22-,26-,27-,28-,29-/m1/s1 | |
XFZJEEAOWLFHDH-NFJBMHMQSA-N | |
C30H26O12 | |
578.142426272 | |
OC=1C=C(O)C2=C(OC(C3=CC=C(O)C(O)=C3)C(O)C2C=4C(O)=CC(O)=C5C4OC(C6=CC=C(O)C(O)=C6)C(O)C5)C1 |
External Identifier | Value |
---|---|
29106-49-8 |
Name | Value |
---|---|
License CC-BY-NC-SA 4.0 International | |
Plant Biology, The Noble Foundation, Ardmore, OK, US/Dennis Fine, Daniel Wherritt, and Lloyd Sumner | |
LC-ESI-TOF | |
impact HD | |
ESI | |
negative | |
Nitrogen | |
0.016 | |
2014-08-20 00:14:06+02:00 | |
Waters Acquity BEH C18 1.7um x 2.1 x 150 mm | |
152.4 | |
C:\Data\Confirmed standards 19_Aug_2014\Procyanidin B2 vial 376_1-E,8_01_662.d | |
2.7626187079908315 | |
0.7439248945133786 |