Name | Value |
---|---|
InChI=1S/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1 | |
OIRDTQYFTABQOQ-KQYNXXCUSA-N | |
C10H13N5O4 | |
267.09675389600005 | |
OCC1OC(N2C=NC=3C(=NC=NC32)N)C(O)C1O |
Name | Value |
---|---|
6.561997 minutes | |
10 | |
Ipputa Tada, Hiroshi Tsugawa, Isabel Meister, Pei Zhang, Rie Shu, Riho Katsumi, Craig E. Wheelock, Masanori Arita, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
KI GIAR zic-HILIC Pos v0.92.msp.txt | |
DDA QTOF | |
DI (direct infusion) | |
1.3004388043824242 | |
0.6253788713540321 | |
268.10400390625 | |
[M+H]+ | |
2.6854867497782053 ppm | |
-7.199897500527186E-4 Da |