Name | Value |
---|---|
InChI=1S/C6H13NO2/c1-3-4(2)5(7)6(8)9/h4-5H,3,7H2,1-2H3,(H,8,9)/t4-,5-/m0/s1 | |
AGPKZVBTJJNPAG-WHFBIAKZSA-N | |
C6H13NO2 | |
131.094628656 | |
O=C(O)C(N)C(C)CC |
Name | Value |
---|---|
6.759775 minutes | |
0 | |
Ipputa Tada, Hiroshi Tsugawa, Isabel Meister, Pei Zhang, Rie Shu, Riho Katsumi, Craig E. Wheelock, Masanori Arita, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS1 | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
KI GIAR zic-HILIC Pos v0.92.msp.txt | |
DDA QTOF | |
DI (direct infusion) | |
1.0413685100775245 | |
0.6470386350614592 | |
132.101913452148 | |
[M+H]+ | |
5.186933588474297 ppm | |
-6.85203851986671E-4 Da |