Name | Value |
---|---|
InChI=1S/C7H15O10P/c8-2-7(12)6(11)5(10)4(9)3(17-7)1-16-18(13,14)15/h3-6,8-12H,1-2H2,(H2,13,14,15)/t3-,4-,5-,6+,7?/m1/s1 | |
CBIDVWSRUUODHL-QTSLKERKSA-N | |
C7H15O10P | |
290.04028331 | |
O=P(O)(O)OCC1OC(O)(CO)C(O)C(O)C1O |
Name | Value |
---|---|
10.01 | |
20 | |
C7H15O10P | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC pHILIC Guard column (2.1 mm x 20 mm, 5 µm particle size) with Merck SeQuant ZIC pHILIC (2.1 x 100 mm, 5 µm particle size, 100 Å) | |
12/88 at 0 min, 40/60 at 8.5 min, 75/25 at 8.7-11.2 min; 12/88 at 11.5-22 min | |
0.28ml/min | |
5 mM ammonium acetate in water with 0.04% NH4OH (pH 9.3) | |
acetonitrile | |
NEG_2020-11-24_V01B_RCH_LC06_tDDA_ChemSTD_219_CPD_Meister2020_OPEN.msp | |
negative | |
1.1415166813717528 | |
0.8234302276535274 | |
289.033020019531 | |
[M-H]- | |
0.04397259180087901 ppm | |
1.2709531006294128E-5 Da |