Name | Value |
---|---|
InChI=1S/C14H17N5O8/c20-2-6-9(23)10(24)13(27-6)19-4-17-8-11(15-3-16-12(8)19)18-5(14(25)26)1-7(21)22/h3-6,9-10,13,20,23-24H,1-2H2,(H,21,22)(H,25,26)(H,15,16,18)/t5-,6+,9+,10+,13-/m0/s1 | |
VKGZCEJTCKHMRL-MDBUBQOGSA-N | |
C14H17N5O8 | |
383.107712504 | |
O=C(O)CC(NC1=NC=NC2=C1N=CN2C3OC(CO)C(O)C3O)C(=O)O |
Name | Value |
---|---|
10 | |
5.406538 | |
C14H17N5O8 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
1.0824882599406624 | |
0.6041482009898526 | |
384.114990234375 | |
[M+H]+ | |
1.8022457925513167 ppm | |
-6.922696250057925E-4 Da |