Name | Value |
---|---|
InChI=1S/C9H14N4O5/c10-7-4(8(11)17)12-2-13(7)9-6(16)5(15)3(1-14)18-9/h2-3,5-6,9,14-16H,1,10H2,(H2,11,17)/t3-,5-,6-,9-/m1/s1 | |
RTRQQBHATOEIAF-UUOKFMHZSA-N | |
C9H14N4O5 | |
258.096419548 | |
N=C(O)C=1N=CN(C1N)C2OC(CO)C(O)C2O |
Name | Value |
---|---|
CC-BY | |
6.367508 | |
30 | |
C9H14N4O5 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
1.6272883034530596 | |
0.5630031150863187 | |
259.103698730469 | |
[M+H]+ | |
2.666181665407853 ppm | |
-6.908175309945364E-4 Da |