Name | Value |
---|---|
InChI=1S/C4H9NO2/c1-2-3(5)4(6)7/h3H,2,5H2,1H3,(H,6,7)/t3-/m0/s1 | |
C4H9NO2 | |
103.063328528 | |
O=C(O)C(N)CC | |
QWCKQJZIFLGMSD-VKHMYHEASA-N |
Name | Value |
---|---|
7.692031 | |
30 | |
C4H9NO2 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
1.745904303262755 | |
0.7945952913831787 | |
104.070602416992 | |
[M+H]+ | |
6.688834232051971 ppm | |
-6.961110079970467E-4 Da |