Name | Value |
---|---|
InChI=1S/C5H10N2O3/c1-3(4(8)9)2-7-5(6)10/h3H,2H2,1H3,(H,8,9)(H3,6,7,10) | |
PHENTZNALBMCQD-UHFFFAOYSA-N | |
C5H10N2O3 | |
146.06914217999997 | |
O=C(O)C(C)CNC(=N)O |
Name | Value |
---|---|
3.694125 | |
[M+H]+ | |
10 | |
C5H10N2O3 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
AIF | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
positive | |
2.5311696854422707 | |
0.7863520754317733 | |
147.076416015625 | |
4.733351504145487 ppm | |
-6.96164374971886E-4 Da |