| Name | Value |
|---|---|
| InChI=1S/C8H9NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-5,7H,9H2,(H,10,11) | |
| ZGUNAGUHMKGQNY-UHFFFAOYSA-N | |
| C8H9NO2 | |
| 151.063328528 | |
| O=C(O)C(N)C=1C=CC=CC1 |
| Name | Value |
|---|---|
| 6.825319 | |
| 10 | |
| C8H9NO2 | |
| Centroid | |
| Isabel Meister, Romanas Chaleckis | |
| Agilent 6550 iFunnel | |
| LC-ESI-QTOF | |
| CC-BY | |
| MS2 | |
| ESI | |
| AIF | |
| Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
| 5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
| 0.3ml/min | |
| water with 0.1% formic acid (pH2.7) | |
| acetonitrile with 0.1% formic acid | |
| POS_2020-06-11_V02-RCH_LC02_AIF_ChemSTD_Meister2020_OPEN.msp | |
| positive | |
| 1.6457924664190757 | |
| 0.7914588765450722 | |
| 152.070602416992 | |
| [M+H]+ | |
| 4.577551459304773 ppm | |
| -6.961110080112576E-4 Da |