Name | Value |
---|---|
InChI=1S/C33H36N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h7-8,13-14,34-35H,1-2,9-12,15H2,3-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/b26-13-,27-14- | |
BPYKTIZUTYGOLE-IFADSCNNSA-N | |
C33H36N4O6 | |
584.2634848719999 | |
O=C(O)CCC1=C(NC(C=C2N=C(O)C(=C2C=C)C)=C1C)CC=3NC(C=C4N=C(O)C(C=C)=C4C)=C(C3CCC(=O)O)C |
Name | Value |
---|---|
1.03 | |
40 | |
positive | |
C33H36N4O6 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
0.6894922696495827 | |
0.331575692718243 | |
585.270751953125 | |
[M+H]+ | |
1.2010148680588328 ppm | |
-7.029188749356763E-4 Da |