Name | Value |
---|---|
InChI=1S/C9H14N4O3/c10-2-1-8(14)13-7(9(15)16)3-6-4-11-5-12-6/h4-5,7H,1-3,10H2,(H,11,12)(H,13,14)(H,15,16)/t7-/m0/s1 | |
CQOVPNPJLQNMDC-ZETCQYMHSA-N | |
C9H14N4O3 | |
226.106590308 | |
O=C(O)C(N=C(O)CCN)CC1=CN=CN1 |
Name | Value |
---|---|
[M+H]+ | |
13.12 | |
40 | |
C9H14N4O3 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
1.8552070691663016 | |
0.7232918902548436 | |
227.113861083984 | |
3.078737742608807 ppm | |
-6.992240159888752E-4 Da |