Name | Value |
---|---|
InChI=1S/C14H11Cl2NO2/c15-10-5-3-6-11(16)14(10)17-12-7-2-1-4-9(12)8-13(18)19/h1-7,17H,8H2,(H,18,19) | |
DCOPUUMXTXDBNB-UHFFFAOYSA-N | |
C14H11Cl2NO2 | |
295.016683952 | |
O=C(O)CC=1C=CC=CC1NC=2C(Cl)=CC=CC2Cl |
Name | Value |
---|---|
1.07 | |
40 | |
C14H11Cl2NO2 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
0.3273809333878744 | |
0.20341321082261957 | |
296.023956298828 | |
[M+H]+ | |
2.3567456522965697 ppm | |
-6.976531719828927E-4 Da |