Name | Value |
---|---|
InChI=1S/C11H15N5O4/c1-15-3-14-10-6(9(15)12)13-4-16(10)11-8(19)7(18)5(2-17)20-11/h3-5,7-8,11-12,17-19H,2H2,1H3/t5-,7-,8-,11-/m1/s1 | |
GFYLSDSUCHVORB-IOSLPCCCSA-N | |
C11H15N5O4 | |
281.11240396 | |
N=C1C=2N=CN(C2N=CN1C)C3OC(CO)C(O)C3O |
Name | Value |
---|---|
8.74 | |
20 | |
C11H15N5O4 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
0.0 | |
NaN | |
282.119689941406 | |
[M+H]+ | |
2.4245687853773474 ppm | |
-6.840185939722687E-4 Da |