Name | Value |
---|---|
InChI=1S/C7H14N2O4S/c8-4(6(10)11)1-2-14-3-5(9)7(12)13/h4-5H,1-3,8-9H2,(H,10,11)(H,12,13)/t4-,5-/m0/s1 | |
ILRYLPWNYFXEMH-WHFBIAKZSA-N | |
C7H14N2O4S | |
222.06742792799997 | |
O=C(O)C(N)CSCCC(N)C(=O)O |
Name | Value |
---|---|
10.81 | |
30 | |
C7H14N2O4S | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
0.6412007591402983 | |
0.35786095742892726 | |
223.07470703125 | |
[M+H]+ | |
3.0971541290684934 ppm | |
-6.908967499725804E-4 Da |