Name | Value |
---|---|
InChI=1S/C4H8N2O3/c5-4(9)6-2-1-3(7)8/h1-2H2,(H,7,8)(H3,5,6,9) | |
JSJWCHRYRHKBBW-UHFFFAOYSA-N | |
C4H8N2O3 | |
132.05349211599997 | |
O=C(O)CCNC(=N)O |
Name | Value |
---|---|
4.58 | |
20 | |
C4H8N2O3 | |
Centroid | |
Isabel Meister, Romanas Chaleckis | |
Agilent 6550 iFunnel | |
LC-ESI-QTOF | |
CC-BY | |
MS2 | |
ESI | |
DDA | |
Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
0.3ml/min | |
water with 0.1% formic acid (pH2.7) | |
acetonitrile with 0.1% formic acid | |
POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
positive | |
2.166248099043797 | |
0.8445578438974235 | |
133.060775756836 | |
[M+H]+ | |
5.1582381064185325 ppm | |
-6.863591639785227E-4 Da |