| Name | Value |
|---|---|
| InChI=1S/C4H8N4O4/c5-3(11)7-1(2(9)10)8-4(6)12/h1H,(H,9,10)(H3,5,7,11)(H3,6,8,12) | |
| NUCLJNSWZCHRKL-UHFFFAOYSA-N | |
| C4H8N4O4 | |
| 176.054554736 | |
| O=C(O)C(NC(=N)O)NC(=N)O |
| Name | Value |
|---|---|
| 7.2 | |
| 30 | |
| C4H8N4O4 | |
| Centroid | |
| Isabel Meister, Romanas Chaleckis | |
| Agilent 6550 iFunnel | |
| LC-ESI-QTOF | |
| CC-BY | |
| MS2 | |
| ESI | |
| DDA | |
| Merck SeQuant ZIC HILIC (2.1 x 100 mm, 3.5 µm particle size) with Merck SeQuant ZIC HILIC Guard column (2.1 mm x 2 mm, 3.5 µm particle size) | |
| 5/95 at 0-1.5 min, 60/40 at 12-14 min, 75/25 at 14.2-17 min; 5/95 at 18-25 min | |
| 0.3ml/min | |
| water with 0.1% formic acid (pH2.7) | |
| acetonitrile with 0.1% formic acid | |
| POS_2020-06-11_V01_RCH_LC02_tDDA_ChemSTD_Meister2020_OPEN.msp | |
| positive | |
| 0.8971315269526706 | |
| 0.6471436024798807 | |
| 177.061828613281 | |
| [M+H]+ | |
| 3.9315233806067424 ppm | |
| -6.961227190060981E-4 Da |