Name | Value |
---|---|
InChI=1S/C21H28O5/c1-20-7-6-13(24)8-12(20)2-3-14-15-4-5-16(18(26)10-22)21(15,11-23)9-17(25)19(14)20/h8,11,14-17,19,22,25H,2-7,9-10H2,1H3/t14-,15-,16+,17-,19+,20-,21+/m0/s1 | |
PQSUYGKTWSAVDQ-ZVIOFETBSA-N | |
C21H28O5 | |
360.19367399600003 | |
O=CC12CC(O)C3C(CCC4=CC(=O)CCC43C)C2CCC1C(=O)CO |
External Identifier | Value |
---|---|
52-39-1 | |
27584 | |
C01780 | |
LMST02030026 | |
5839 | |
5633 |
Name | Value |
---|---|
NA000087 | |
2018.08.29 | |
Tobias Schulze, Hubert Schupke, Martin Krauss, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC BY | |
Copyright (C) 2018 | |
360.1937 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
95 % (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5 at 32 min | |
300 uL/min | |
9.786 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.9.1 | |
positive | |
1.5598942002466483 | |
0.7501505423357651 | |
361.201 | |
[M+H]+ | |
1.7829297261302532 ppm | |
-6.439960000079736E-4 Da |