Name | Value |
---|---|
InChI=1S/C17H19NO3/c19-17(18-10-4-1-5-11-18)7-3-2-6-14-8-9-15-16(12-14)21-13-20-15/h2-3,6-9,12H,1,4-5,10-11,13H2/b6-2+,7-3+ | |
MXXWOMGUGJBKIW-YPCIICBESA-N | |
C17H19NO3 | |
285.136493468 | |
O=C(C=CC=CC1=CC=C2OCOC2=C1)N3CCCCC3 |
External Identifier | Value |
---|---|
94-62-2 | |
28821 | |
C03882 | |
638024 | |
553590 |
Name | Value |
---|---|
NA000155 | |
2018.08.29 | |
Tobias Schulze, Hubert Schupke, Martin Krauss, Department of Effect-Directed Analysis, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany | |
CC BY | |
Copyright (C) 2018 | |
285.1365 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
35 % (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50 x 2.1 mm | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5 at 32 min | |
300 uL/min | |
11.792 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.9.1 | |
positive | |
0.7169281108656288 | |
0.25857715755493393 | |
286.1438 | |
[M+H]+ | |
2.3186523699883708 ppm | |
-6.634680000274784E-4 Da |