Name | Value |
---|---|
InChI=1S/C18H25NO5/c1-4-12-9-11(2)18(3,22)17(21)23-10-13-5-7-19-8-6-14(15(13)19)24-16(12)20/h4-5,11,14-15,22H,6-10H2,1-3H3/b12-4-/t11-,14-,15-,18-/m1/s1 | |
HKODIGSRFALUTA-JTLQZVBZSA-N | |
C18H25NO5 | |
335.17327290000003 | |
O=C1OC2CCN3CC=C(COC(=O)C(O)(C)C(C)CC1=CC)C32 |
External Identifier | Value |
---|---|
130-01-8 | |
9107 | |
C06176 | |
5280906 | |
10254883 |
Name | Value |
---|---|
2019.02.28 | |
NA000419 | |
Tobias Schulze, Jawameer Hama, Hubert Schupke, Martin Krauss, Helmholtz Centre for Environmental Research GmbH - UFZ, Leipzig, Germany and University of Copenhagen (UCPH), Denmark | |
CC BY | |
Copyright (C) 2019 | |
335.1733 | |
LTQ Orbitrap XL Thermo Scientific | |
LC-ESI-ITFT | |
MS2 | |
ESI | |
CID | |
25 % (nominal) | |
15000 | |
Kinetex Evo C18 2.6 um 50x2.1 mm, Phenomenex | |
95/5 at 0 min, 95/5 at 1 min, 0/100 at 13 min, 0/100 at 24 min, 95/5 at 24.3 min, 95/5 at 32 min | |
300 uL/min | |
5.913 min | |
water with 0.1% formic acid | |
methanol with 0.1% formic acid | |
loess on assigned fragments and MS1 | |
Peaks with additional N2/O included | |
RMassBank 2.11.0 | |
positive | |
0.6471807576580477 | |
0.9336844696320276 | |
336.1805 | |
[M+H]+ | |
2.2098247817297456 ppm | |
-7.429000000342967E-4 Da |